C14H15ClN2OS — CID 106514723
6-(5-chloro-2-methoxyphenyl)-2-ethyl-5-methyl-1H-pyrimidine-4-thione (PubChem CID 106514723) has the molecular formula C14H15ClN2OS and a molecular weight of 294.81 g/mol. Its IUPAC name is 6-(5-chloro-2-methoxyphenyl)-2-ethyl-5-methyl-1H-pyrimidine-4-thione.
| Compound Name | 6-(5-chloro-2-methoxyphenyl)-2-ethyl-5-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106514723 |
| Molecular Formula | C14H15ClN2OS |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 6-(5-chloro-2-methoxyphenyl)-2-ethyl-5-methyl-1H-pyrimidine-4-thione |
| SMILES | CCc1nc(=S)c(C)c(-c2cc(Cl)ccc2OC)[nH]1 |
| InChI | InChI=1S/C14H15ClN2OS/c1-4-12-16-13(8(2)14(19)17-12)10-7-9(15)5-6-11(10)18-3/h5-7H,4H2,1-3H3,(H,16,17,19) |
| InChIKey | FSLMILJMHYRAEN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|