C15H17FN2OS — CID 106520553
6-(2-fluoro-3-methoxyphenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione (PubChem CID 106520553) has the molecular formula C15H17FN2OS and a molecular weight of 292.38 g/mol. Its IUPAC name is 6-(2-fluoro-3-methoxyphenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione.
| Compound Name | 6-(2-fluoro-3-methoxyphenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106520553 |
| Molecular Formula | C15H17FN2OS |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6-(2-fluoro-3-methoxyphenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1nc(=S)c(C)c(-c2cccc(OC)c2F)[nH]1 |
| InChI | InChI=1S/C15H17FN2OS/c1-4-6-12-17-14(9(2)15(20)18-12)10-7-5-8-11(19-3)13(10)16/h5,7-8H,4,6H2,1-3H3,(H,17,18,20) |
| InChIKey | SIQLCUFHWOBFBK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|