C14H14F2N2S — CID 106518243
6-(2,3-difluorophenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione (PubChem CID 106518243) has the molecular formula C14H14F2N2S and a molecular weight of 280.34 g/mol. Its IUPAC name is 6-(2,3-difluorophenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione.
| Compound Name | 6-(2,3-difluorophenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106518243 |
| Molecular Formula | C14H14F2N2S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 6-(2,3-difluorophenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1nc(=S)c(C)c(-c2cccc(F)c2F)[nH]1 |
| InChI | InChI=1S/C14H14F2N2S/c1-3-5-11-17-13(8(2)14(19)18-11)9-6-4-7-10(15)12(9)16/h4,6-7H,3,5H2,1-2H3,(H,17,18,19) |
| InChIKey | LDPJMHUPUVFKRI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|