C14H14Cl2N2S — CID 106514926
6-(2,5-dichlorophenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione (PubChem CID 106514926) has the molecular formula C14H14Cl2N2S and a molecular weight of 313.25 g/mol. Its IUPAC name is 6-(2,5-dichlorophenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione.
| Compound Name | 6-(2,5-dichlorophenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106514926 |
| Molecular Formula | C14H14Cl2N2S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 6-(2,5-dichlorophenyl)-5-methyl-2-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1nc(=S)c(C)c(-c2cc(Cl)ccc2Cl)[nH]1 |
| InChI | InChI=1S/C14H14Cl2N2S/c1-3-4-12-17-13(8(2)14(19)18-12)10-7-9(15)5-6-11(10)16/h5-7H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | JOBMUKDLRMNOKA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|