C13H13FN2OS — CID 106520559
6-(2-fluoro-3-methoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione (PubChem CID 106520559) has the molecular formula C13H13FN2OS and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-(2-fluoro-3-methoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione.
| Compound Name | 6-(2-fluoro-3-methoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106520559 |
| Molecular Formula | C13H13FN2OS |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 6-(2-fluoro-3-methoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione |
| SMILES | COc1cccc(-c2[nH]c(C)nc(=S)c2C)c1F |
| InChI | InChI=1S/C13H13FN2OS/c1-7-12(15-8(2)16-13(7)18)9-5-4-6-10(17-3)11(9)14/h4-6H,1-3H3,(H,15,16,18) |
| InChIKey | HSEQEMTUJJITOQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|