C14H16N2OS — CID 106517107
6-(2-ethoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione (PubChem CID 106517107) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 6-(2-ethoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione.
| Compound Name | 6-(2-ethoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106517107 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 6-(2-ethoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione |
| SMILES | CCOc1ccccc1-c1[nH]c(C)nc(=S)c1C |
| InChI | InChI=1S/C14H16N2OS/c1-4-17-12-8-6-5-7-11(12)13-9(2)14(18)16-10(3)15-13/h5-8H,4H2,1-3H3,(H,15,16,18) |
| InChIKey | YUOBBVSOKINNAB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|