C12H13N3S — CID 106518953
2,5-dimethyl-6-(4-methyl-3-pyridinyl)-1H-pyrimidine-4-thione (PubChem CID 106518953) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 2,5-dimethyl-6-(4-methyl-3-pyridinyl)-1H-pyrimidine-4-thione.
| Compound Name | 2,5-dimethyl-6-(4-methyl-3-pyridinyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106518953 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 2,5-dimethyl-6-(4-methyl-3-pyridinyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(=S)c(C)c(-c2cnccc2C)[nH]1 |
| InChI | InChI=1S/C12H13N3S/c1-7-4-5-13-6-10(7)11-8(2)12(16)15-9(3)14-11/h4-6H,1-3H3,(H,14,15,16) |
| InChIKey | ANUDPXFNOKVVGR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|