C18H16N2S — CID 106518680
2,5-dimethyl-6-(4-phenylphenyl)-1H-pyrimidine-4-thione (PubChem CID 106518680) has the molecular formula C18H16N2S and a molecular weight of 292.41 g/mol. Its IUPAC name is 2,5-dimethyl-6-(4-phenylphenyl)-1H-pyrimidine-4-thione.
| Compound Name | 2,5-dimethyl-6-(4-phenylphenyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106518680 |
| Molecular Formula | C18H16N2S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2,5-dimethyl-6-(4-phenylphenyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(=S)c(C)c(-c2ccc(-c3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C18H16N2S/c1-12-17(19-13(2)20-18(12)21)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11H,1-2H3,(H,19,20,21) |
| InChIKey | IYJZJBKEBLZDEZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|