C13H11F3N2OS — CID 106517635
2,5-dimethyl-6-[3-(trifluoromethoxy)phenyl]-1H-pyrimidine-4-thione (PubChem CID 106517635) has the molecular formula C13H11F3N2OS and a molecular weight of 300.31 g/mol. Its IUPAC name is 2,5-dimethyl-6-[3-(trifluoromethoxy)phenyl]-1H-pyrimidine-4-thione.
| Compound Name | 2,5-dimethyl-6-[3-(trifluoromethoxy)phenyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106517635 |
| Molecular Formula | C13H11F3N2OS |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2,5-dimethyl-6-[3-(trifluoromethoxy)phenyl]-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(=S)c(C)c(-c2cccc(OC(F)(F)F)c2)[nH]1 |
| InChI | InChI=1S/C13H11F3N2OS/c1-7-11(17-8(2)18-12(7)20)9-4-3-5-10(6-9)19-13(14,15)16/h3-6H,1-2H3,(H,17,18,20) |
| InChIKey | PQPLRDSAHXXVFU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|