C17H20N2S2 — CID 106482238
2-(cyclopentylsulfanylmethyl)-5-methyl-6-phenyl-1H-pyrimidine-4-thione (PubChem CID 106482238) has the molecular formula C17H20N2S2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 2-(cyclopentylsulfanylmethyl)-5-methyl-6-phenyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(cyclopentylsulfanylmethyl)-5-methyl-6-phenyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482238 |
| Molecular Formula | C17H20N2S2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-(cyclopentylsulfanylmethyl)-5-methyl-6-phenyl-1H-pyrimidine-4-thione |
| SMILES | Cc1c(-c2ccccc2)[nH]c(CSC2CCCC2)nc1=S |
| InChI | InChI=1S/C17H20N2S2/c1-12-16(13-7-3-2-4-8-13)18-15(19-17(12)20)11-21-14-9-5-6-10-14/h2-4,7-8,14H,5-6,9-11H2,1H3,(H,18,19,20) |
| InChIKey | CEKMFPPNYXNHSM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|