C15H21BrN2S2 — CID 106482052
5-bromo-6-cyclopentyl-2-(cyclopentylsulfanylmethyl)-1H-pyrimidine-4-thione (PubChem CID 106482052) has the molecular formula C15H21BrN2S2 and a molecular weight of 373.39 g/mol. Its IUPAC name is 5-bromo-6-cyclopentyl-2-(cyclopentylsulfanylmethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopentyl-2-(cyclopentylsulfanylmethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482052 |
| Molecular Formula | C15H21BrN2S2 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 5-bromo-6-cyclopentyl-2-(cyclopentylsulfanylmethyl)-1H-pyrimidine-4-thione |
| SMILES | S=c1nc(CSC2CCCC2)[nH]c(C2CCCC2)c1Br |
| InChI | InChI=1S/C15H21BrN2S2/c16-13-14(10-5-1-2-6-10)17-12(18-15(13)19)9-20-11-7-3-4-8-11/h10-11H,1-9H2,(H,17,18,19) |
| InChIKey | HJGOAXQNJLUWII-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|