C14H16BrN3S2 — CID 106482214
5-bromo-6-cyclopentyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-pyrimidine-4-thione (PubChem CID 106482214) has the molecular formula C14H16BrN3S2 and a molecular weight of 370.34 g/mol. Its IUPAC name is 5-bromo-6-cyclopentyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopentyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482214 |
| Molecular Formula | C14H16BrN3S2 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 5-bromo-6-cyclopentyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(Cc2nc(=S)c(Br)c(C3CCCC3)[nH]2)cs1 |
| InChI | InChI=1S/C14H16BrN3S2/c1-8-16-10(7-20-8)6-11-17-13(9-4-2-3-5-9)12(15)14(19)18-11/h7,9H,2-6H2,1H3,(H,17,18,19) |
| InChIKey | FSRNZCUOCRBTDJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|