C13H11F3N2S — CID 106516812
2,5-dimethyl-6-[2-(trifluoromethyl)phenyl]-1H-pyrimidine-4-thione (PubChem CID 106516812) has the molecular formula C13H11F3N2S and a molecular weight of 284.31 g/mol. Its IUPAC name is 2,5-dimethyl-6-[2-(trifluoromethyl)phenyl]-1H-pyrimidine-4-thione.
| Compound Name | 2,5-dimethyl-6-[2-(trifluoromethyl)phenyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106516812 |
| Molecular Formula | C13H11F3N2S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2,5-dimethyl-6-[2-(trifluoromethyl)phenyl]-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(=S)c(C)c(-c2ccccc2C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C13H11F3N2S/c1-7-11(17-8(2)18-12(7)19)9-5-3-4-6-10(9)13(14,15)16/h3-6H,1-2H3,(H,17,18,19) |
| InChIKey | NVLGLJFWSNFKKA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|