C12H10F3N3S — CID 106522562
2,5-dimethyl-6-[4-(trifluoromethyl)-3-pyridinyl]-1H-pyrimidine-4-thione (PubChem CID 106522562) has the molecular formula C12H10F3N3S and a molecular weight of 285.29 g/mol. Its IUPAC name is 2,5-dimethyl-6-[4-(trifluoromethyl)-3-pyridinyl]-1H-pyrimidine-4-thione.
| Compound Name | 2,5-dimethyl-6-[4-(trifluoromethyl)-3-pyridinyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106522562 |
| Molecular Formula | C12H10F3N3S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2,5-dimethyl-6-[4-(trifluoromethyl)-3-pyridinyl]-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(=S)c(C)c(-c2cnccc2C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C12H10F3N3S/c1-6-10(17-7(2)18-11(6)19)8-5-16-4-3-9(8)12(13,14)15/h3-5H,1-2H3,(H,17,18,19) |
| InChIKey | XJTMFQSNHDCFNS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|