C8H4F3N3OS — CID 139919806
3-[4-(trifluoromethyl)-3-pyridinyl]-2H-1,2,4-oxadiazole-5-thione (PubChem CID 139919806) has the molecular formula C8H4F3N3OS and a molecular weight of 247.20 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)-3-pyridinyl]-2H-1,2,4-oxadiazole-5-thione.
| Compound Name | 3-[4-(trifluoromethyl)-3-pyridinyl]-2H-1,2,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 139919806 |
| Molecular Formula | C8H4F3N3OS |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 3-[4-(trifluoromethyl)-3-pyridinyl]-2H-1,2,4-oxadiazole-5-thione |
| SMILES | FC(F)(F)c1ccncc1-c1nc(=S)o[nH]1 |
| InChI | InChI=1S/C8H4F3N3OS/c9-8(10,11)5-1-2-12-3-4(5)6-13-7(16)15-14-6/h1-3H,(H,13,14,16) |
| InChIKey | JXBLUPLDGTZUCB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|