C16H20N2O2S — CID 106515166
6-(3,4-diethoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione (PubChem CID 106515166) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 6-(3,4-diethoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione.
| Compound Name | 6-(3,4-diethoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106515166 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 6-(3,4-diethoxyphenyl)-2,5-dimethyl-1H-pyrimidine-4-thione |
| SMILES | CCOc1ccc(-c2[nH]c(C)nc(=S)c2C)cc1OCC |
| InChI | InChI=1S/C16H20N2O2S/c1-5-19-13-8-7-12(9-14(13)20-6-2)15-10(3)16(21)18-11(4)17-15/h7-9H,5-6H2,1-4H3,(H,17,18,21) |
| InChIKey | HLYJUCKRIVYWMV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|