About 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole
2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole (PubChem CID 71563513) has the molecular formula C13H16N2O3
and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole |
| PubChem CID | 71563513 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole |
| SMILES | CCOc1ccc(-c2nnc(C)o2)cc1OCC |
| InChI | InChI=1S/C13H16N2O3/c1-4-16-11-7-6-10(8-12(11)17-5-2)13-15-14-9(3)18-13/h6-8H,4-5H2,1-3H3 |
| InChIKey | GFSDPYAXQQNUCT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole?
The IUPAC name of 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole (CID 71563513) is 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole.
What is the SMILES notation for 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole?
The canonical SMILES for 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole is CCOc1ccc(-c2nnc(C)o2)cc1OCC.
What is the InChIKey of 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole?
The InChIKey is GFSDPYAXQQNUCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3/c1-4-16-11-7-6-10(8-12(11)17-5-2)13-15-14-9(3)18-13/h6-8H,4-5H2,1-3H3.
What are the key properties of 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole?
2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole has a molecular weight of 248.28 g/mol, XLogP of 2.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-diethoxyphenyl)-5-methyl-1,3,4-oxadiazole is sourced from PubChem (CID 71563513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).