C20H21N3O5 — CID 43975865
N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-methoxybenzamide (PubChem CID 43975865) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-methoxybenzamide.
| Compound Name | N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 43975865 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-methoxybenzamide |
| SMILES | CCOc1ccc(-c2nnc(NC(=O)c3ccc(OC)cc3)o2)cc1OCC |
| InChI | InChI=1S/C20H21N3O5/c1-4-26-16-11-8-14(12-17(16)27-5-2)19-22-23-20(28-19)21-18(24)13-6-9-15(25-3)10-7-13/h6-12H,4-5H2,1-3H3,(H,21,23,24) |
| InChIKey | UJXBAEUVEDDBOI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |