C24H29N3O5 — CID 43975905
N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-pentoxybenzamide (PubChem CID 43975905) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-pentoxybenzamide.
| Compound Name | N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-pentoxybenzamide |
|---|---|
| PubChem CID | 43975905 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-pentoxybenzamide |
| SMILES | CCCCCOc1cccc(C(=O)Nc2nnc(-c3ccc(OCC)c(OCC)c3)o2)c1 |
| InChI | InChI=1S/C24H29N3O5/c1-4-7-8-14-31-19-11-9-10-17(15-19)22(28)25-24-27-26-23(32-24)18-12-13-20(29-5-2)21(16-18)30-6-3/h9-13,15-16H,4-8,14H2,1-3H3,(H,25,27,28) |
| InChIKey | MPZCSEXISFIAGM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|