C23H27N3O5S — CID 41227499
4-pentoxy-N-[5-(3-propan-2-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 41227499) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is 4-pentoxy-N-[5-(3-propan-2-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 4-pentoxy-N-[5-(3-propan-2-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 41227499 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 4-pentoxy-N-[5-(3-propan-2-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2nnc(-c3cccc(S(=O)(=O)C(C)C)c3)o2)cc1 |
| InChI | InChI=1S/C23H27N3O5S/c1-4-5-6-14-30-19-12-10-17(11-13-19)21(27)24-23-26-25-22(31-23)18-8-7-9-20(15-18)32(28,29)16(2)3/h7-13,15-16H,4-6,14H2,1-3H3,(H,24,26,27) |
| InChIKey | GBXMNTIABVJNSL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|