C22H25N3O3 — CID 43976718
N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-3-pentoxybenzamide (PubChem CID 43976718) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-3-pentoxybenzamide.
| Compound Name | N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-3-pentoxybenzamide |
|---|---|
| PubChem CID | 43976718 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-3-pentoxybenzamide |
| SMILES | CCCCCOc1cccc(C(=O)Nc2nnc(-c3cc(C)cc(C)c3)o2)c1 |
| InChI | InChI=1S/C22H25N3O3/c1-4-5-6-10-27-19-9-7-8-17(14-19)20(26)23-22-25-24-21(28-22)18-12-15(2)11-16(3)13-18/h7-9,11-14H,4-6,10H2,1-3H3,(H,23,25,26) |
| InChIKey | JSEGDCFLCIBUCA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|