C20H21N3O4 — CID 4525703
3-butoxy-N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 4525703) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-butoxy-N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 3-butoxy-N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4525703 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-butoxy-N-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2nnc(-c3cccc(OC)c3)o2)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-3-4-11-26-17-10-5-7-14(12-17)18(24)21-20-23-22-19(27-20)15-8-6-9-16(13-15)25-2/h5-10,12-13H,3-4,11H2,1-2H3,(H,21,23,24) |
| InChIKey | HXAMRAYOYLLPKU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|