C22H25N3O5S — CID 41226892
4-butoxy-N-[5-(4-propan-2-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 41226892) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 4-butoxy-N-[5-(4-propan-2-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 4-butoxy-N-[5-(4-propan-2-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 41226892 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-butoxy-N-[5-(4-propan-2-ylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2nnc(-c3ccc(S(=O)(=O)C(C)C)cc3)o2)cc1 |
| InChI | InChI=1S/C22H25N3O5S/c1-4-5-14-29-18-10-6-16(7-11-18)20(26)23-22-25-24-21(30-22)17-8-12-19(13-9-17)31(27,28)15(2)3/h6-13,15H,4-5,14H2,1-3H3,(H,23,25,26) |
| InChIKey | QNFKEPSTMJSBDP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|