C25H23N3O4 — CID 43975859
N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-phenylbenzamide (PubChem CID 43975859) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-phenylbenzamide.
| Compound Name | N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 43975859 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[5-(3,4-diethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-phenylbenzamide |
| SMILES | CCOc1ccc(-c2nnc(NC(=O)c3ccc(-c4ccccc4)cc3)o2)cc1OCC |
| InChI | InChI=1S/C25H23N3O4/c1-3-30-21-15-14-20(16-22(21)31-4-2)24-27-28-25(32-24)26-23(29)19-12-10-18(11-13-19)17-8-6-5-7-9-17/h5-16H,3-4H2,1-2H3,(H,26,28,29) |
| InChIKey | XCWJPWGUDREEFO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |