C24H28O5 — CID 11069311
2,5-bis(4-ethoxy-3-methoxyphenyl)-3,4-dimethylfuran (PubChem CID 11069311) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is 2,5-bis(4-ethoxy-3-methoxyphenyl)-3,4-dimethylfuran.
| Compound Name | 2,5-bis(4-ethoxy-3-methoxyphenyl)-3,4-dimethylfuran |
|---|---|
| PubChem CID | 11069311 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2,5-bis(4-ethoxy-3-methoxyphenyl)-3,4-dimethylfuran |
| SMILES | CCOc1ccc(-c2oc(-c3ccc(OCC)c(OC)c3)c(C)c2C)cc1OC |
| InChI | InChI=1S/C24H28O5/c1-7-27-19-11-9-17(13-21(19)25-5)23-15(3)16(4)24(29-23)18-10-12-20(28-8-2)22(14-18)26-6/h9-14H,7-8H2,1-6H3 |
| InChIKey | FXDSEDUSYJZTAQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |