C40H44O5 — CID 19049290
2,5-bis(3-methoxy-4-phenylmethoxyphenyl)-3,4-bis(2-methylpropyl)furan (PubChem CID 19049290) has the molecular formula C40H44O5 and a molecular weight of 604.79 g/mol. Its IUPAC name is 2,5-bis(3-methoxy-4-phenylmethoxyphenyl)-3,4-bis(2-methylpropyl)furan.
| Compound Name | 2,5-bis(3-methoxy-4-phenylmethoxyphenyl)-3,4-bis(2-methylpropyl)furan |
|---|---|
| PubChem CID | 19049290 |
| Molecular Formula | C40H44O5 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | 2,5-bis(3-methoxy-4-phenylmethoxyphenyl)-3,4-bis(2-methylpropyl)furan |
| SMILES | COc1cc(-c2oc(-c3ccc(OCc4ccccc4)c(OC)c3)c(CC(C)C)c2CC(C)C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C40H44O5/c1-27(2)21-33-34(22-28(3)4)40(32-18-20-36(38(24-32)42-6)44-26-30-15-11-8-12-16-30)45-39(33)31-17-19-35(37(23-31)41-5)43-25-29-13-9-7-10-14-29/h7-20,23-24,27-28H,21-22,25-26H2,1-6H3 |
| InChIKey | ZLWGBYSOGMPLPZ-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |