C17H15ClN2O3 — CID 46944561
2-(chloromethyl)-5-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4-oxadiazole (PubChem CID 46944561) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 46944561 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-(chloromethyl)-5-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4-oxadiazole |
| SMILES | COc1cc(-c2nnc(CCl)o2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C17H15ClN2O3/c1-21-15-9-13(17-20-19-16(10-18)23-17)7-8-14(15)22-11-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3 |
| InChIKey | WMIGPLSAQZYFHT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|