C19H21N3O3 — CID 110653110
N-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-phenylethanamine (PubChem CID 110653110) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-phenylethanamine.
| Compound Name | N-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 110653110 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-phenylethanamine |
| SMILES | COc1ccc(-c2nnc(CNCCc3ccccc3)o2)cc1OC |
| InChI | InChI=1S/C19H21N3O3/c1-23-16-9-8-15(12-17(16)24-2)19-22-21-18(25-19)13-20-11-10-14-6-4-3-5-7-14/h3-9,12,20H,10-11,13H2,1-2H3 |
| InChIKey | RVAXHJUGKCHDFE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|