C21H21NO3 — CID 169408827
3-(3,4-dimethoxyphenyl)-4-phenylmethoxyaniline (PubChem CID 169408827) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-phenylmethoxyaniline.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-phenylmethoxyaniline |
|---|---|
| PubChem CID | 169408827 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-phenylmethoxyaniline |
| SMILES | COc1ccc(-c2cc(N)ccc2OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C21H21NO3/c1-23-20-10-8-16(12-21(20)24-2)18-13-17(22)9-11-19(18)25-14-15-6-4-3-5-7-15/h3-13H,14,22H2,1-2H3 |
| InChIKey | RIKJWKJGRKGPBF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|