C14H14O2 — CID 174530188
methanol;2-phenylmethoxybicyclo[3.1.0]hexa-1,3,5-triene (PubChem CID 174530188) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is methanol;2-phenylmethoxybicyclo[3.1.0]hexa-1,3,5-triene.
| Compound Name | methanol;2-phenylmethoxybicyclo[3.1.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 174530188 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | methanol;2-phenylmethoxybicyclo[3.1.0]hexa-1,3,5-triene |
| SMILES | CO.c1ccc(COc2ccc3cc2-3)cc1 |
| InChI | InChI=1S/C13H10O.CH4O/c1-2-4-10(5-3-1)9-14-13-7-6-11-8-12(11)13;1-2/h1-8H,9H2;2H,1H3 |
| InChIKey | ILAFSNCODLMROZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |