C27H25NO4 — CID 23538933
4-[4-(3-amino-4-phenylmethoxyphenyl)-2,5-dimethoxyphenyl]phenol (PubChem CID 23538933) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-[4-(3-amino-4-phenylmethoxyphenyl)-2,5-dimethoxyphenyl]phenol.
| Compound Name | 4-[4-(3-amino-4-phenylmethoxyphenyl)-2,5-dimethoxyphenyl]phenol |
|---|---|
| PubChem CID | 23538933 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-[4-(3-amino-4-phenylmethoxyphenyl)-2,5-dimethoxyphenyl]phenol |
| SMILES | COc1cc(-c2ccc(OCc3ccccc3)c(N)c2)c(OC)cc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C27H25NO4/c1-30-26-16-23(27(31-2)15-22(26)19-8-11-21(29)12-9-19)20-10-13-25(24(28)14-20)32-17-18-6-4-3-5-7-18/h3-16,29H,17,28H2,1-2H3 |
| InChIKey | HOBBDWLDCKRXGT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|