C15H17NO — CID 174428998
ethanamine;2-phenylmethoxybicyclo[3.1.0]hexa-1,3,5-triene (PubChem CID 174428998) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is ethanamine;2-phenylmethoxybicyclo[3.1.0]hexa-1,3,5-triene.
| Compound Name | ethanamine;2-phenylmethoxybicyclo[3.1.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 174428998 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | ethanamine;2-phenylmethoxybicyclo[3.1.0]hexa-1,3,5-triene |
| SMILES | CCN.c1ccc(COc2ccc3cc2-3)cc1 |
| InChI | InChI=1S/C13H10O.C2H7N/c1-2-4-10(5-3-1)9-14-13-7-6-11-8-12(11)13;1-2-3/h1-8H,9H2;2-3H2,1H3 |
| InChIKey | JFTBVGITRNKBHG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |