C60H50O8 — CID 102320796
4-[2,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]-4-(4-hydroxyphenyl)phenyl]phenol (PubChem CID 102320796) has the molecular formula C60H50O8 and a molecular weight of 899.05 g/mol. Its IUPAC name is 4-[2,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]-4-(4-hydroxyphenyl)phenyl]phenol.
| Compound Name | 4-[2,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]-4-(4-hydroxyphenyl)phenyl]phenol |
|---|---|
| PubChem CID | 102320796 |
| Molecular Formula | C60H50O8 |
| Molecular Weight | 899.05 g/mol |
| Exact Mass | 898.35 |
| IUPAC Name | 4-[2,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]-4-(4-hydroxyphenyl)phenyl]phenol |
| SMILES | Oc1ccc(-c2cc(OCc3cc(OCc4ccccc4)cc(OCc4ccccc4)c3)c(-c3ccc(O)cc3)cc2OCc2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C60H50O8/c61-51-25-21-49(22-26-51)57-36-60(68-42-48-31-55(65-39-45-17-9-3-10-18-45)34-56(32-48)66-40-46-19-11-4-12-20-46)58(50-23-27-52(62)28-24-50)35-59(57)67-41-47-29-53(63-37-43-13-5-1-6-14-43)33-54(30-47)64-38-44-15-7-2-8-16-44/h1-36,61-62H,37-42H2 |
| InChIKey | VDDPQQYCZCCWCN-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.05 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |