About [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite
[7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite (PubChem CID 68975076) has the molecular formula C25H21BrO7
and a molecular weight of 513.34 g/mol. Its IUPAC name is [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite.
Molecular Properties
| Compound Name | [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite |
| PubChem CID | 68975076 |
| Molecular Formula | C25H21BrO7 |
| Molecular Weight | 513.34 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite |
| SMILES | COc1cc(-c2oc3c(OC)c(OC)ccc3c(=O)c2OBr)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H21BrO7/c1-28-19-12-10-17-21(27)25(33-26)22(32-23(17)24(19)30-3)16-9-11-18(20(13-16)29-2)31-14-15-7-5-4-6-8-15/h4-13H,14H2,1-3H3 |
| InChIKey | BJGFPKJGQYGTFV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.34 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite?
The IUPAC name of [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite (CID 68975076) is [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite.
What is the SMILES notation for [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite?
The canonical SMILES for [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite is COc1cc(-c2oc3c(OC)c(OC)ccc3c(=O)c2OBr)ccc1OCc1ccccc1.
What is the InChIKey of [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite?
The InChIKey is BJGFPKJGQYGTFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21BrO7/c1-28-19-12-10-17-21(27)25(33-26)22(32-23(17)24(19)30-3)16-9-11-18(20(13-16)29-2)31-14-15-7-5-4-6-8-15/h4-13H,14H2,1-3H3.
What are the key properties of [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite?
[7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite has a molecular weight of 513.34 g/mol, XLogP of 5.75, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [7,8-dimethoxy-2-(3-methoxy-4-phenylmethoxyphenyl)-4-oxochromen-3-yl] hypobromite is sourced from PubChem (CID 68975076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).