C37H30O9S — CID 11607081
[2-[3,4-bis(phenylmethoxy)phenyl]-5-hydroxy-4-oxo-7-phenylmethoxychromen-3-yl] methanesulfonate (PubChem CID 11607081) has the molecular formula C37H30O9S and a molecular weight of 650.71 g/mol. Its IUPAC name is [2-[3,4-bis(phenylmethoxy)phenyl]-5-hydroxy-4-oxo-7-phenylmethoxychromen-3-yl] methanesulfonate.
| Compound Name | [2-[3,4-bis(phenylmethoxy)phenyl]-5-hydroxy-4-oxo-7-phenylmethoxychromen-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 11607081 |
| Molecular Formula | C37H30O9S |
| Molecular Weight | 650.71 g/mol |
| Exact Mass | 650.16 |
| IUPAC Name | [2-[3,4-bis(phenylmethoxy)phenyl]-5-hydroxy-4-oxo-7-phenylmethoxychromen-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1c(-c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)oc2cc(OCc3ccccc3)cc(O)c2c1=O |
| InChI | InChI=1S/C37H30O9S/c1-47(40,41)46-37-35(39)34-30(38)20-29(42-22-25-11-5-2-6-12-25)21-33(34)45-36(37)28-17-18-31(43-23-26-13-7-3-8-14-26)32(19-28)44-24-27-15-9-4-10-16-27/h2-21,38H,22-24H2,1H3 |
| InChIKey | WMQCGFQTBVQZJY-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|