C26H25NO3 — CID 144577684
2-[2-(3-aminophenyl)ethyl]-3,8-dimethyl-7-phenylmethoxychromen-4-one (PubChem CID 144577684) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[2-(3-aminophenyl)ethyl]-3,8-dimethyl-7-phenylmethoxychromen-4-one.
| Compound Name | 2-[2-(3-aminophenyl)ethyl]-3,8-dimethyl-7-phenylmethoxychromen-4-one |
|---|---|
| PubChem CID | 144577684 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[2-(3-aminophenyl)ethyl]-3,8-dimethyl-7-phenylmethoxychromen-4-one |
| SMILES | Cc1c(CCc2cccc(N)c2)oc2c(C)c(OCc3ccccc3)ccc2c1=O |
| InChI | InChI=1S/C26H25NO3/c1-17-24(13-11-19-9-6-10-21(27)15-19)30-26-18(2)23(14-12-22(26)25(17)28)29-16-20-7-4-3-5-8-20/h3-10,12,14-15H,11,13,16,27H2,1-2H3 |
| InChIKey | MCVWZSGOZASSFA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|