About ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate
ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate (PubChem CID 102381033) has the molecular formula C22H23NO5
and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate |
| PubChem CID | 102381033 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1c(C)c2ccc(OCc3ccccc3)c(C)c2oc1=O |
| InChI | InChI=1S/C22H23NO5/c1-4-26-19(24)12-23-20-14(2)17-10-11-18(15(3)21(17)28-22(20)25)27-13-16-8-6-5-7-9-16/h5-11,23H,4,12-13H2,1-3H3 |
| InChIKey | ZXUXCZHUYMVILY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate?
The IUPAC name of ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate (CID 102381033) is ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate.
What is the SMILES notation for ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate?
The canonical SMILES for ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate is CCOC(=O)CNc1c(C)c2ccc(OCc3ccccc3)c(C)c2oc1=O.
What is the InChIKey of ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate?
The InChIKey is ZXUXCZHUYMVILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO5/c1-4-26-19(24)12-23-20-14(2)17-10-11-18(15(3)21(17)28-22(20)25)27-13-16-8-6-5-7-9-16/h5-11,23H,4,12-13H2,1-3H3.
What are the key properties of ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate?
ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate has a molecular weight of 381.43 g/mol, XLogP of 3.96, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate is sourced from PubChem (CID 102381033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).