C22H23NO5 — CID 102381033
ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate (PubChem CID 102381033) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate.
| Compound Name | ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate |
|---|---|
| PubChem CID | 102381033 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl 2-[(4,8-dimethyl-2-oxo-7-phenylmethoxychromen-3-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1c(C)c2ccc(OCc3ccccc3)c(C)c2oc1=O |
| InChI | InChI=1S/C22H23NO5/c1-4-26-19(24)12-23-20-14(2)17-10-11-18(15(3)21(17)28-22(20)25)27-13-16-8-6-5-7-9-16/h5-11,23H,4,12-13H2,1-3H3 |
| InChIKey | ZXUXCZHUYMVILY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|