C38H39NO8 — CID 23438938
3-O-ethyl 5-O-[1-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyethyl] 2,6-dimethyl-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 23438938) has the molecular formula C38H39NO8 and a molecular weight of 637.73 g/mol. Its IUPAC name is 3-O-ethyl 5-O-[1-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyethyl] 2,6-dimethyl-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-[1-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyethyl] 2,6-dimethyl-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 23438938 |
| Molecular Formula | C38H39NO8 |
| Molecular Weight | 637.73 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | 3-O-ethyl 5-O-[1-(3,4,8-trimethyl-2-oxochromen-7-yl)oxyethyl] 2,6-dimethyl-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)Oc2ccc3c(C)c(C)c(=O)oc3c2C)C1c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C38H39NO8/c1-8-43-37(41)32-24(5)39-25(6)33(34(32)29-16-12-13-17-31(29)44-20-27-14-10-9-11-15-27)38(42)46-26(7)45-30-19-18-28-21(2)22(3)36(40)47-35(28)23(30)4/h9-19,26,34,39H,8,20H2,1-7H3 |
| InChIKey | SCKDMYRDLXQVRG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|