C31H32O5 — CID 71540003
ethyl 4-[8-ethyl-4-methyl-2-oxo-7-[(4-phenylphenyl)methoxy]chromen-3-yl]butanoate (PubChem CID 71540003) has the molecular formula C31H32O5 and a molecular weight of 484.59 g/mol. Its IUPAC name is ethyl 4-[8-ethyl-4-methyl-2-oxo-7-[(4-phenylphenyl)methoxy]chromen-3-yl]butanoate.
| Compound Name | ethyl 4-[8-ethyl-4-methyl-2-oxo-7-[(4-phenylphenyl)methoxy]chromen-3-yl]butanoate |
|---|---|
| PubChem CID | 71540003 |
| Molecular Formula | C31H32O5 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | ethyl 4-[8-ethyl-4-methyl-2-oxo-7-[(4-phenylphenyl)methoxy]chromen-3-yl]butanoate |
| SMILES | CCOC(=O)CCCc1c(C)c2ccc(OCc3ccc(-c4ccccc4)cc3)c(CC)c2oc1=O |
| InChI | InChI=1S/C31H32O5/c1-4-25-28(35-20-22-14-16-24(17-15-22)23-10-7-6-8-11-23)19-18-26-21(3)27(31(33)36-30(25)26)12-9-13-29(32)34-5-2/h6-8,10-11,14-19H,4-5,9,12-13,20H2,1-3H3 |
| InChIKey | LNLIPSJQVCMFEM-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|