C19H24O5 — CID 7013187
2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetic acid (PubChem CID 7013187) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetic acid.
| Compound Name | 2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetic acid |
|---|---|
| PubChem CID | 7013187 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetic acid |
| SMILES | CCCCCCc1c(C)c2ccc(OCC(=O)O)c(C)c2oc1=O |
| InChI | InChI=1S/C19H24O5/c1-4-5-6-7-8-15-12(2)14-9-10-16(23-11-17(20)21)13(3)18(14)24-19(15)22/h9-10H,4-8,11H2,1-3H3,(H,20,21) |
| InChIKey | XVWAHGIUZVRYQQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|