C26H37NO6 — CID 3849242
6-[2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]hexanoic acid (PubChem CID 3849242) has the molecular formula C26H37NO6 and a molecular weight of 459.58 g/mol. Its IUPAC name is 6-[2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]hexanoic acid.
| Compound Name | 6-[2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 3849242 |
| Molecular Formula | C26H37NO6 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 6-[2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]hexanoic acid |
| SMILES | CCCCCCc1c(C)c2ccc(OC(C)C(=O)NCCCCCC(=O)O)c(C)c2oc1=O |
| InChI | InChI=1S/C26H37NO6/c1-5-6-7-9-12-21-17(2)20-14-15-22(18(3)24(20)33-26(21)31)32-19(4)25(30)27-16-11-8-10-13-23(28)29/h14-15,19H,5-13,16H2,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | FLRGTEULBKFICC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|