C21H28O3 — CID 44789775
7-but-3-en-2-yloxy-3-hexyl-4,8-dimethylchromen-2-one (PubChem CID 44789775) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 7-but-3-en-2-yloxy-3-hexyl-4,8-dimethylchromen-2-one.
| Compound Name | 7-but-3-en-2-yloxy-3-hexyl-4,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 44789775 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 7-but-3-en-2-yloxy-3-hexyl-4,8-dimethylchromen-2-one |
| SMILES | C=CC(C)Oc1ccc2c(C)c(CCCCCC)c(=O)oc2c1C |
| InChI | InChI=1S/C21H28O3/c1-6-8-9-10-11-18-15(4)17-12-13-19(23-14(3)7-2)16(5)20(17)24-21(18)22/h7,12-14H,2,6,8-11H2,1,3-5H3 |
| InChIKey | IOPAAAMLOWSFGO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|