C25H27FO4 — CID 2030183
7-[2-(4-fluorophenyl)-2-oxoethoxy]-3-hexyl-4,8-dimethylchromen-2-one (PubChem CID 2030183) has the molecular formula C25H27FO4 and a molecular weight of 410.49 g/mol. Its IUPAC name is 7-[2-(4-fluorophenyl)-2-oxoethoxy]-3-hexyl-4,8-dimethylchromen-2-one.
| Compound Name | 7-[2-(4-fluorophenyl)-2-oxoethoxy]-3-hexyl-4,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 2030183 |
| Molecular Formula | C25H27FO4 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 7-[2-(4-fluorophenyl)-2-oxoethoxy]-3-hexyl-4,8-dimethylchromen-2-one |
| SMILES | CCCCCCc1c(C)c2ccc(OCC(=O)c3ccc(F)cc3)c(C)c2oc1=O |
| InChI | InChI=1S/C25H27FO4/c1-4-5-6-7-8-21-16(2)20-13-14-23(17(3)24(20)30-25(21)28)29-15-22(27)18-9-11-19(26)12-10-18/h9-14H,4-8,15H2,1-3H3 |
| InChIKey | LNHGJDDKYISUCY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|