C26H24O4 — CID 2292470
4-butyl-8-methyl-7-(2-naphthalen-2-yl-2-oxoethoxy)chromen-2-one (PubChem CID 2292470) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is 4-butyl-8-methyl-7-(2-naphthalen-2-yl-2-oxoethoxy)chromen-2-one.
| Compound Name | 4-butyl-8-methyl-7-(2-naphthalen-2-yl-2-oxoethoxy)chromen-2-one |
|---|---|
| PubChem CID | 2292470 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-butyl-8-methyl-7-(2-naphthalen-2-yl-2-oxoethoxy)chromen-2-one |
| SMILES | CCCCc1cc(=O)oc2c(C)c(OCC(=O)c3ccc4ccccc4c3)ccc12 |
| InChI | InChI=1S/C26H24O4/c1-3-4-7-20-15-25(28)30-26-17(2)24(13-12-22(20)26)29-16-23(27)21-11-10-18-8-5-6-9-19(18)14-21/h5-6,8-15H,3-4,7,16H2,1-2H3 |
| InChIKey | GMIUITMATCDANW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|