C17H20N2O6 — CID 166604078
2-[8-(2-amino-2-oxoethoxy)-4-butyl-2-oxochromen-7-yl]oxyacetamide (PubChem CID 166604078) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[8-(2-amino-2-oxoethoxy)-4-butyl-2-oxochromen-7-yl]oxyacetamide.
| Compound Name | 2-[8-(2-amino-2-oxoethoxy)-4-butyl-2-oxochromen-7-yl]oxyacetamide |
|---|---|
| PubChem CID | 166604078 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[8-(2-amino-2-oxoethoxy)-4-butyl-2-oxochromen-7-yl]oxyacetamide |
| SMILES | CCCCc1cc(=O)oc2c(OCC(N)=O)c(OCC(N)=O)ccc12 |
| InChI | InChI=1S/C17H20N2O6/c1-2-3-4-10-7-15(22)25-16-11(10)5-6-12(23-8-13(18)20)17(16)24-9-14(19)21/h5-7H,2-4,8-9H2,1H3,(H2,18,20)(H2,19,21) |
| InChIKey | WHZGOGUQTKMTPG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|