C19H21NO8 — CID 71951004
2-[[2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxyacetyl]amino]butanedioic acid (PubChem CID 71951004) has the molecular formula C19H21NO8 and a molecular weight of 391.38 g/mol. Its IUPAC name is 2-[[2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxyacetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxyacetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 71951004 |
| Molecular Formula | C19H21NO8 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[[2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxyacetyl]amino]butanedioic acid |
| SMILES | CCCc1cc(=O)oc2c(C)c(OCC(=O)NC(CC(=O)O)C(=O)O)ccc12 |
| InChI | InChI=1S/C19H21NO8/c1-3-4-11-7-17(24)28-18-10(2)14(6-5-12(11)18)27-9-15(21)20-13(19(25)26)8-16(22)23/h5-7,13H,3-4,8-9H2,1-2H3,(H,20,21)(H,22,23)(H,25,26) |
| InChIKey | RUECZFXGDRDGQX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|