C20H25NO6 — CID 44667762
(2R)-2-[[2-(4-ethyl-8-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-methylpentanoic acid (PubChem CID 44667762) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is (2R)-2-[[2-(4-ethyl-8-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-methylpentanoic acid.
| Compound Name | (2R)-2-[[2-(4-ethyl-8-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 44667762 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2R)-2-[[2-(4-ethyl-8-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-methylpentanoic acid |
| SMILES | CCc1cc(=O)oc2c(C)c(OCC(=O)N[C@@H](C(=O)O)C(C)CC)ccc12 |
| InChI | InChI=1S/C20H25NO6/c1-5-11(3)18(20(24)25)21-16(22)10-26-15-8-7-14-13(6-2)9-17(23)27-19(14)12(15)4/h7-9,11,18H,5-6,10H2,1-4H3,(H,21,22)(H,24,25)/t11?,18-/m1/s1 |
| InChIKey | QRDQSTNEKCZZRI-KKIBXBACSA-N |
| XLogP | 2.66 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|