C14H15NO4 — CID 770817
2-(4-ethyl-8-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 770817) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-(4-ethyl-8-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | 2-(4-ethyl-8-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 770817 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-(4-ethyl-8-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | CCc1cc(=O)oc2c(C)c(OCC(N)=O)ccc12 |
| InChI | InChI=1S/C14H15NO4/c1-3-9-6-13(17)19-14-8(2)11(5-4-10(9)14)18-7-12(15)16/h4-6H,3,7H2,1-2H3,(H2,15,16) |
| InChIKey | AVPMQDYECOMFTB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|