C19H16Cl2O3 — CID 2299030
7-[(3,4-dichlorophenyl)methoxy]-4-ethyl-8-methylchromen-2-one (PubChem CID 2299030) has the molecular formula C19H16Cl2O3 and a molecular weight of 363.24 g/mol. Its IUPAC name is 7-[(3,4-dichlorophenyl)methoxy]-4-ethyl-8-methylchromen-2-one.
| Compound Name | 7-[(3,4-dichlorophenyl)methoxy]-4-ethyl-8-methylchromen-2-one |
|---|---|
| PubChem CID | 2299030 |
| Molecular Formula | C19H16Cl2O3 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 7-[(3,4-dichlorophenyl)methoxy]-4-ethyl-8-methylchromen-2-one |
| SMILES | CCc1cc(=O)oc2c(C)c(OCc3ccc(Cl)c(Cl)c3)ccc12 |
| InChI | InChI=1S/C19H16Cl2O3/c1-3-13-9-18(22)24-19-11(2)17(7-5-14(13)19)23-10-12-4-6-15(20)16(21)8-12/h4-9H,3,10H2,1-2H3 |
| InChIKey | ZVLIYKPWZRYZMW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|