C17H12Cl2O4 — CID 18291345
4-[(2,4-dichlorophenoxy)methyl]-7-hydroxy-8-methylchromen-2-one (PubChem CID 18291345) has the molecular formula C17H12Cl2O4 and a molecular weight of 351.19 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenoxy)methyl]-7-hydroxy-8-methylchromen-2-one.
| Compound Name | 4-[(2,4-dichlorophenoxy)methyl]-7-hydroxy-8-methylchromen-2-one |
|---|---|
| PubChem CID | 18291345 |
| Molecular Formula | C17H12Cl2O4 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 4-[(2,4-dichlorophenoxy)methyl]-7-hydroxy-8-methylchromen-2-one |
| SMILES | Cc1c(O)ccc2c(COc3ccc(Cl)cc3Cl)cc(=O)oc12 |
| InChI | InChI=1S/C17H12Cl2O4/c1-9-14(20)4-3-12-10(6-16(21)23-17(9)12)8-22-15-5-2-11(18)7-13(15)19/h2-7,20H,8H2,1H3 |
| InChIKey | UYPBNRQITOXKLW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|